C15H21N5O — CID 655833
2,6-dimethyl-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-9-yl)morpholine (PubChem CID 655833) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 2,6-dimethyl-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-9-yl)morpholine.
| Compound Name | 2,6-dimethyl-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-9-yl)morpholine |
|---|---|
| PubChem CID | 655833 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2,6-dimethyl-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-9-yl)morpholine |
| SMILES | CC1CN(c2c3c(nc4ncnn24)CCCC3)CC(C)O1 |
| InChI | InChI=1S/C15H21N5O/c1-10-7-19(8-11(2)21-10)14-12-5-3-4-6-13(12)18-15-16-9-17-20(14)15/h9-11H,3-8H2,1-2H3 |
| InChIKey | OQLHIYQOPPJFEB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |