About N-(3,5-dimethoxyphenyl)morpholine-4-carboxamide
N-(3,5-dimethoxyphenyl)morpholine-4-carboxamide (PubChem CID 655891) has the molecular formula C13H18N2O4
and a molecular weight of 266.30 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)morpholine-4-carboxamide.
Molecular Properties
| Compound Name | N-(3,5-dimethoxyphenyl)morpholine-4-carboxamide |
| PubChem CID | 655891 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)morpholine-4-carboxamide |
| SMILES | COc1cc(NC(=O)N2CCOCC2)cc(OC)c1 |
| InChI | InChI=1S/C13H18N2O4/c1-17-11-7-10(8-12(9-11)18-2)14-13(16)15-3-5-19-6-4-15/h7-9H,3-6H2,1-2H3,(H,14,16) |
| InChIKey | MFSPTHKEAYATOI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3,5-dimethoxyphenyl)morpholine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethoxyphenyl)morpholine-4-carboxamide?
The IUPAC name of N-(3,5-dimethoxyphenyl)morpholine-4-carboxamide (CID 655891) is N-(3,5-dimethoxyphenyl)morpholine-4-carboxamide.
What is the SMILES notation for N-(3,5-dimethoxyphenyl)morpholine-4-carboxamide?
The canonical SMILES for N-(3,5-dimethoxyphenyl)morpholine-4-carboxamide is COc1cc(NC(=O)N2CCOCC2)cc(OC)c1.
What is the InChIKey of N-(3,5-dimethoxyphenyl)morpholine-4-carboxamide?
The InChIKey is MFSPTHKEAYATOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O4/c1-17-11-7-10(8-12(9-11)18-2)14-13(16)15-3-5-19-6-4-15/h7-9H,3-6H2,1-2H3,(H,14,16).
What are the key properties of N-(3,5-dimethoxyphenyl)morpholine-4-carboxamide?
N-(3,5-dimethoxyphenyl)morpholine-4-carboxamide has a molecular weight of 266.30 g/mol, XLogP of 1.57, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethoxyphenyl)morpholine-4-carboxamide is sourced from PubChem (CID 655891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).