C24H25N3O3 — CID 655901
[4-(3-carbazol-9-yl-2-hydroxypropyl)piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 655901) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is [4-(3-carbazol-9-yl-2-hydroxypropyl)piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-(3-carbazol-9-yl-2-hydroxypropyl)piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 655901 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | [4-(3-carbazol-9-yl-2-hydroxypropyl)piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCN(CC(O)Cn2c3ccccc3c3ccccc32)CC1 |
| InChI | InChI=1S/C24H25N3O3/c28-18(16-25-11-13-26(14-12-25)24(29)23-10-5-15-30-23)17-27-21-8-3-1-6-19(21)20-7-2-4-9-22(20)27/h1-10,15,18,28H,11-14,16-17H2 |
| InChIKey | QZNOGWXLGHKSCQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |