C17H12ClFN2O2S — CID 6559091
(3R,7aS)-6-(4-chlorophenyl)-3-(4-fluorophenyl)-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione (PubChem CID 6559091) has the molecular formula C17H12ClFN2O2S and a molecular weight of 362.81 g/mol. Its IUPAC name is (3R,7aS)-6-(4-chlorophenyl)-3-(4-fluorophenyl)-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione.
| Compound Name | (3R,7aS)-6-(4-chlorophenyl)-3-(4-fluorophenyl)-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione |
|---|---|
| PubChem CID | 6559091 |
| Molecular Formula | C17H12ClFN2O2S |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | (3R,7aS)-6-(4-chlorophenyl)-3-(4-fluorophenyl)-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione |
| SMILES | O=C1[C@H]2CS[C@H](c3ccc(F)cc3)N2C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H12ClFN2O2S/c18-11-3-7-13(8-4-11)20-15(22)14-9-24-16(21(14)17(20)23)10-1-5-12(19)6-2-10/h1-8,14,16H,9H2/t14-,16-/m1/s1 |
| InChIKey | VXPKRYQJIBJFDE-GDBMZVCRSA-N |
| XLogP | 4.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|