C22H27N3O3 — CID 655920
3-N-(2,3-dimethylphenyl)-1-N-(2-methoxyphenyl)piperidine-1,3-dicarboxamide (PubChem CID 655920) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-N-(2,3-dimethylphenyl)-1-N-(2-methoxyphenyl)piperidine-1,3-dicarboxamide.
| Compound Name | 3-N-(2,3-dimethylphenyl)-1-N-(2-methoxyphenyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 655920 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 3-N-(2,3-dimethylphenyl)-1-N-(2-methoxyphenyl)piperidine-1,3-dicarboxamide |
| SMILES | COc1ccccc1NC(=O)N1CCCC(C(=O)Nc2cccc(C)c2C)C1 |
| InChI | InChI=1S/C22H27N3O3/c1-15-8-6-11-18(16(15)2)23-21(26)17-9-7-13-25(14-17)22(27)24-19-10-4-5-12-20(19)28-3/h4-6,8,10-12,17H,7,9,13-14H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | LMAQDESVPXCBAL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |