C23H15ClN4O4 — CID 6559302
(5S,10bS)-2-(4-chlorophenyl)-9-nitrospiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,3'-1H-indole]-2'-one (PubChem CID 6559302) has the molecular formula C23H15ClN4O4 and a molecular weight of 446.85 g/mol. Its IUPAC name is (5S,10bS)-2-(4-chlorophenyl)-9-nitrospiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,3'-1H-indole]-2'-one.
| Compound Name | (5S,10bS)-2-(4-chlorophenyl)-9-nitrospiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 6559302 |
| Molecular Formula | C23H15ClN4O4 |
| Molecular Weight | 446.85 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | (5S,10bS)-2-(4-chlorophenyl)-9-nitrospiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,3'-1H-indole]-2'-one |
| SMILES | O=C1Nc2ccccc2[C@]12Oc1ccc([N+](=O)[O-])cc1[C@@H]1CC(c3ccc(Cl)cc3)=NN12 |
| InChI | InChI=1S/C23H15ClN4O4/c24-14-7-5-13(6-8-14)19-12-20-16-11-15(28(30)31)9-10-21(16)32-23(27(20)26-19)17-3-1-2-4-18(17)25-22(23)29/h1-11,20H,12H2,(H,25,29)/t20-,23-/m0/s1 |
| InChIKey | GPRWYOIZBKPXHL-REWPJTCUSA-N |
| XLogP | 4.60 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.85 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|