About 3,6-dimethyl-1-(5-pyrrolidin-1-ylpentyl)pyrimidine-2,4-dione
3,6-dimethyl-1-(5-pyrrolidin-1-ylpentyl)pyrimidine-2,4-dione (PubChem CID 655968) has the molecular formula C15H25N3O2
and a molecular weight of 279.38 g/mol. Its IUPAC name is 3,6-dimethyl-1-(5-pyrrolidin-1-ylpentyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3,6-dimethyl-1-(5-pyrrolidin-1-ylpentyl)pyrimidine-2,4-dione |
| PubChem CID | 655968 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 3,6-dimethyl-1-(5-pyrrolidin-1-ylpentyl)pyrimidine-2,4-dione |
| SMILES | Cc1cc(=O)n(C)c(=O)n1CCCCCN1CCCC1 |
| InChI | InChI=1S/C15H25N3O2/c1-13-12-14(19)16(2)15(20)18(13)11-5-3-4-8-17-9-6-7-10-17/h12H,3-11H2,1-2H3 |
| InChIKey | ZRLSCSUWGPXHFZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dimethyl-1-(5-pyrrolidin-1-ylpentyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-1-(5-pyrrolidin-1-ylpentyl)pyrimidine-2,4-dione?
The IUPAC name of 3,6-dimethyl-1-(5-pyrrolidin-1-ylpentyl)pyrimidine-2,4-dione (CID 655968) is 3,6-dimethyl-1-(5-pyrrolidin-1-ylpentyl)pyrimidine-2,4-dione.
What is the SMILES notation for 3,6-dimethyl-1-(5-pyrrolidin-1-ylpentyl)pyrimidine-2,4-dione?
The canonical SMILES for 3,6-dimethyl-1-(5-pyrrolidin-1-ylpentyl)pyrimidine-2,4-dione is Cc1cc(=O)n(C)c(=O)n1CCCCCN1CCCC1.
What is the InChIKey of 3,6-dimethyl-1-(5-pyrrolidin-1-ylpentyl)pyrimidine-2,4-dione?
The InChIKey is ZRLSCSUWGPXHFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O2/c1-13-12-14(19)16(2)15(20)18(13)11-5-3-4-8-17-9-6-7-10-17/h12H,3-11H2,1-2H3.
What are the key properties of 3,6-dimethyl-1-(5-pyrrolidin-1-ylpentyl)pyrimidine-2,4-dione?
3,6-dimethyl-1-(5-pyrrolidin-1-ylpentyl)pyrimidine-2,4-dione has a molecular weight of 279.38 g/mol, XLogP of 1.12, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-1-(5-pyrrolidin-1-ylpentyl)pyrimidine-2,4-dione is sourced from PubChem (CID 655968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).