C7H13NO3 — CID 6560290
(2R,4R)-4-hydroxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylate (PubChem CID 6560290) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is (2R,4R)-4-hydroxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylate.
| Compound Name | (2R,4R)-4-hydroxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 6560290 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (2R,4R)-4-hydroxy-1,1-dimethylpyrrolidin-1-ium-2-carboxylate |
| SMILES | C[N+]1(C)C[C@H](O)C[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C7H13NO3/c1-8(2)4-5(9)3-6(8)7(10)11/h5-6,9H,3-4H2,1-2H3/t5-,6-/m1/s1 |
| InChIKey | MUNWAHDYFVYIKH-PHDIDXHHSA-N |
| XLogP | -2.05 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|