C23H25FN4O5S — CID 656031
N'-[1-(4-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-(furan-2-ylmethyl)-N-(1,3-thiazol-2-yl)butanediamide (PubChem CID 656031) has the molecular formula C23H25FN4O5S and a molecular weight of 488.54 g/mol. Its IUPAC name is N'-[1-(4-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-(furan-2-ylmethyl)-N-(1,3-thiazol-2-yl)butanediamide.
| Compound Name | N'-[1-(4-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-(furan-2-ylmethyl)-N-(1,3-thiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 656031 |
| Molecular Formula | C23H25FN4O5S |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | N'-[1-(4-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-(furan-2-ylmethyl)-N-(1,3-thiazol-2-yl)butanediamide |
| SMILES | COCCNC(=O)C(c1ccc(F)cc1)N(Cc1ccco1)C(=O)CCC(=O)Nc1nccs1 |
| InChI | InChI=1S/C23H25FN4O5S/c1-32-13-10-25-22(31)21(16-4-6-17(24)7-5-16)28(15-18-3-2-12-33-18)20(30)9-8-19(29)27-23-26-11-14-34-23/h2-7,11-12,14,21H,8-10,13,15H2,1H3,(H,25,31)(H,26,27,29) |
| InChIKey | JJVQMHLXTNONAJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|