About 2-(1,3-dimethyl-2,6-dioxo-7-propan-2-ylpurin-8-yl)sulfanyl-N-(furan-2-ylmethyl)acetamide
2-(1,3-dimethyl-2,6-dioxo-7-propan-2-ylpurin-8-yl)sulfanyl-N-(furan-2-ylmethyl)acetamide (PubChem CID 656060) has the molecular formula C17H21N5O4S
and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxo-7-propan-2-ylpurin-8-yl)sulfanyl-N-(furan-2-ylmethyl)acetamide.
Molecular Properties
| Compound Name | 2-(1,3-dimethyl-2,6-dioxo-7-propan-2-ylpurin-8-yl)sulfanyl-N-(furan-2-ylmethyl)acetamide |
| PubChem CID | 656060 |
| Molecular Formula | C17H21N5O4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxo-7-propan-2-ylpurin-8-yl)sulfanyl-N-(furan-2-ylmethyl)acetamide |
| SMILES | CC(C)n1c(SCC(=O)NCc2ccco2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C17H21N5O4S/c1-10(2)22-13-14(20(3)17(25)21(4)15(13)24)19-16(22)27-9-12(23)18-8-11-6-5-7-26-11/h5-7,10H,8-9H2,1-4H3,(H,18,23) |
| InChIKey | MPOLLPLDJVMHFP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-(1,3-dimethyl-2,6-dioxo-7-propan-2-ylpurin-8-yl)sulfanyl-N-(furan-2-ylmethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dimethyl-2,6-dioxo-7-propan-2-ylpurin-8-yl)sulfanyl-N-(furan-2-ylmethyl)acetamide?
The IUPAC name of 2-(1,3-dimethyl-2,6-dioxo-7-propan-2-ylpurin-8-yl)sulfanyl-N-(furan-2-ylmethyl)acetamide (CID 656060) is 2-(1,3-dimethyl-2,6-dioxo-7-propan-2-ylpurin-8-yl)sulfanyl-N-(furan-2-ylmethyl)acetamide.
What is the SMILES notation for 2-(1,3-dimethyl-2,6-dioxo-7-propan-2-ylpurin-8-yl)sulfanyl-N-(furan-2-ylmethyl)acetamide?
The canonical SMILES for 2-(1,3-dimethyl-2,6-dioxo-7-propan-2-ylpurin-8-yl)sulfanyl-N-(furan-2-ylmethyl)acetamide is CC(C)n1c(SCC(=O)NCc2ccco2)nc2c1c(=O)n(C)c(=O)n2C.
What is the InChIKey of 2-(1,3-dimethyl-2,6-dioxo-7-propan-2-ylpurin-8-yl)sulfanyl-N-(furan-2-ylmethyl)acetamide?
The InChIKey is MPOLLPLDJVMHFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N5O4S/c1-10(2)22-13-14(20(3)17(25)21(4)15(13)24)19-16(22)27-9-12(23)18-8-11-6-5-7-26-11/h5-7,10H,8-9H2,1-4H3,(H,18,23).
What are the key properties of 2-(1,3-dimethyl-2,6-dioxo-7-propan-2-ylpurin-8-yl)sulfanyl-N-(furan-2-ylmethyl)acetamide?
2-(1,3-dimethyl-2,6-dioxo-7-propan-2-ylpurin-8-yl)sulfanyl-N-(furan-2-ylmethyl)acetamide has a molecular weight of 391.45 g/mol, XLogP of 1.02, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dimethyl-2,6-dioxo-7-propan-2-ylpurin-8-yl)sulfanyl-N-(furan-2-ylmethyl)acetamide is sourced from PubChem (CID 656060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).