About 2-methylpropanal
2-methylpropanal (PubChem CID 6561) has the molecular formula C4H8O
and a molecular weight of 72.11 g/mol. Its IUPAC name is 2-methylpropanal.
Molecular Properties
| Compound Name | 2-methylpropanal |
| PubChem CID | 6561 |
| Molecular Formula | C4H8O |
| Molecular Weight | 72.11 g/mol |
| Exact Mass | 72.06 |
| IUPAC Name | 2-methylpropanal |
| SMILES | CC(C)C=O |
| InChI | InChI=1S/C4H8O/c1-4(2)3-5/h3-4H,1-2H3 |
| InChIKey | AMIMRNSIRUDHCM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 72.11 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanal?
The IUPAC name of 2-methylpropanal (CID 6561) is 2-methylpropanal.
What is the SMILES notation for 2-methylpropanal?
The canonical SMILES for 2-methylpropanal is CC(C)C=O.
What is the InChIKey of 2-methylpropanal?
The InChIKey is AMIMRNSIRUDHCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O/c1-4(2)3-5/h3-4H,1-2H3.
What are the key properties of 2-methylpropanal?
2-methylpropanal has a molecular weight of 72.11 g/mol, XLogP of 0.84, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanal is sourced from PubChem (CID 6561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).