C25H31FN4O5 — CID 656162
N-[(4-Fluoro-phenyl)-(2-methoxy-ethylcarbamoyl)-methyl]-N'-pyridin-2-yl-N-(tetrahydro-furan-2-ylmethyl)-succinamide (PubChem CID 656162) has the molecular formula C25H31FN4O5 and a molecular weight of 486.50 g/mol. Its IUPAC name is N'-[1-(4-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-(oxolan-2-ylmethyl)-N-pyridin-2-ylbutanediamide.
| Compound Name | N-[(4-Fluoro-phenyl)-(2-methoxy-ethylcarbamoyl)-methyl]-N'-pyridin-2-yl-N-(tetrahydro-furan-2-ylmethyl)-succinamide |
|---|---|
| PubChem CID | 656162 |
| Molecular Formula | C25H31FN4O5 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | N'-[1-(4-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-(oxolan-2-ylmethyl)-N-pyridin-2-ylbutanediamide |
| SMILES | COCCNC(=O)C(C1=CC=C(C=C1)F)N(CC2CCCO2)C(=O)CCC(=O)NC3=CC=CC=N3 |
| InChI | InChI=1S/C25H31FN4O5/c1-34-16-14-28-25(33)24(18-7-9-19(26)10-8-18)30(17-20-5-4-15-35-20)23(32)12-11-22(31)29-21-6-2-3-13-27-21/h2-3,6-10,13,20,24H,4-5,11-12,14-17H2,1H3,(H,28,33)(H,27,29,31) |
| InChIKey | MPYQOHLGYAWDMJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | 689 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|