About methyl 1,5-dimethylazuleno[6,7-b]furan-8-carboxylate
methyl 1,5-dimethylazuleno[6,7-b]furan-8-carboxylate (PubChem CID 656394) has the molecular formula C16H14O3
and a molecular weight of 254.28 g/mol. Its IUPAC name is methyl 1,5-dimethylazuleno[6,7-b]furan-8-carboxylate.
Molecular Properties
| Compound Name | methyl 1,5-dimethylazuleno[6,7-b]furan-8-carboxylate |
| PubChem CID | 656394 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | methyl 1,5-dimethylazuleno[6,7-b]furan-8-carboxylate |
| SMILES | COC(=O)c1ccc2c(C)cc3occ(C)c3cc1-2 |
| InChI | InChI=1S/C16H14O3/c1-9-6-15-13(10(2)8-19-15)7-14-11(9)4-5-12(14)16(17)18-3/h4-8H,1-3H3 |
| InChIKey | IRGLEIHRANDEHS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 1,5-dimethylazuleno[6,7-b]furan-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1,5-dimethylazuleno[6,7-b]furan-8-carboxylate?
The IUPAC name of methyl 1,5-dimethylazuleno[6,7-b]furan-8-carboxylate (CID 656394) is methyl 1,5-dimethylazuleno[6,7-b]furan-8-carboxylate.
What is the SMILES notation for methyl 1,5-dimethylazuleno[6,7-b]furan-8-carboxylate?
The canonical SMILES for methyl 1,5-dimethylazuleno[6,7-b]furan-8-carboxylate is COC(=O)c1ccc2c(C)cc3occ(C)c3cc1-2.
What is the InChIKey of methyl 1,5-dimethylazuleno[6,7-b]furan-8-carboxylate?
The InChIKey is IRGLEIHRANDEHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O3/c1-9-6-15-13(10(2)8-19-15)7-14-11(9)4-5-12(14)16(17)18-3/h4-8H,1-3H3.
What are the key properties of methyl 1,5-dimethylazuleno[6,7-b]furan-8-carboxylate?
methyl 1,5-dimethylazuleno[6,7-b]furan-8-carboxylate has a molecular weight of 254.28 g/mol, XLogP of 3.94, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1,5-dimethylazuleno[6,7-b]furan-8-carboxylate is sourced from PubChem (CID 656394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).