C33H59N5O9 — CID 656470
13-butan-2-yl-20-hexyl-6-(1-hydroxyethyl)-10-(hydroxymethyl)-17,19-dimethyl-16-(2-methylpropyl)-1-oxa-4,7,11,14,17-pentazacycloicosane-2,5,8,12,15,18-hexone (PubChem CID 656470) has the molecular formula C33H59N5O9 and a molecular weight of 669.86 g/mol. Its IUPAC name is 13-butan-2-yl-20-hexyl-6-(1-hydroxyethyl)-10-(hydroxymethyl)-17,19-dimethyl-16-(2-methylpropyl)-1-oxa-4,7,11,14,17-pentazacycloicosane-2,5,8,12,15,18-hexone.
| Compound Name | 13-butan-2-yl-20-hexyl-6-(1-hydroxyethyl)-10-(hydroxymethyl)-17,19-dimethyl-16-(2-methylpropyl)-1-oxa-4,7,11,14,17-pentazacycloicosane-2,5,8,12,15,18-hexone |
|---|---|
| PubChem CID | 656470 |
| Molecular Formula | C33H59N5O9 |
| Molecular Weight | 669.86 g/mol |
| Exact Mass | 669.43 |
| IUPAC Name | 13-butan-2-yl-20-hexyl-6-(1-hydroxyethyl)-10-(hydroxymethyl)-17,19-dimethyl-16-(2-methylpropyl)-1-oxa-4,7,11,14,17-pentazacycloicosane-2,5,8,12,15,18-hexone |
| SMILES | CCCCCCC1OC(=O)CNC(=O)C(C(C)O)NC(=O)CC(CO)NC(=O)C(C(C)CC)NC(=O)C(CC(C)C)N(C)C(=O)C1C |
| InChI | InChI=1S/C33H59N5O9/c1-9-11-12-13-14-25-21(6)33(46)38(8)24(15-19(3)4)30(43)37-28(20(5)10-2)32(45)35-23(18-39)16-26(41)36-29(22(7)40)31(44)34-17-27(42)47-25/h19-25,28-29,39-40H,9-18H2,1-8H3,(H,34,44)(H,35,45)(H,36,41)(H,37,43) |
| InChIKey | QFGUPICSJMTWLU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 203.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.86 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|