About 3-[[(1R,2S,4S)-bicyclo[2.2.1]heptane-2-carbonyl]amino]propyl-trimethylazanium
3-[[(1R,2S,4S)-bicyclo[2.2.1]heptane-2-carbonyl]amino]propyl-trimethylazanium (PubChem CID 6565756) has the molecular formula C14H27N2O+
and a molecular weight of 239.38 g/mol. Its IUPAC name is 3-[[(1R,2S,4S)-bicyclo[2.2.1]heptane-2-carbonyl]amino]propyl-trimethylazanium.
Molecular Properties
| Compound Name | 3-[[(1R,2S,4S)-bicyclo[2.2.1]heptane-2-carbonyl]amino]propyl-trimethylazanium |
| PubChem CID | 6565756 |
| Molecular Formula | C14H27N2O+ |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.21 |
| IUPAC Name | 3-[[(1R,2S,4S)-bicyclo[2.2.1]heptane-2-carbonyl]amino]propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCNC(=O)[C@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C14H26N2O/c1-16(2,3)8-4-7-15-14(17)13-10-11-5-6-12(13)9-11/h11-13H,4-10H2,1-3H3/p+1/t11-,12+,13-/m0/s1 |
| InChIKey | ATPREZXWWGWYMJ-XQQFMLRXSA-O |
| XLogP | 1.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(1R,2S,4S)-bicyclo[2.2.1]heptane-2-carbonyl]amino]propyl-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(1R,2S,4S)-bicyclo[2.2.1]heptane-2-carbonyl]amino]propyl-trimethylazanium?
The IUPAC name of 3-[[(1R,2S,4S)-bicyclo[2.2.1]heptane-2-carbonyl]amino]propyl-trimethylazanium (CID 6565756) is 3-[[(1R,2S,4S)-bicyclo[2.2.1]heptane-2-carbonyl]amino]propyl-trimethylazanium.
What is the SMILES notation for 3-[[(1R,2S,4S)-bicyclo[2.2.1]heptane-2-carbonyl]amino]propyl-trimethylazanium?
The canonical SMILES for 3-[[(1R,2S,4S)-bicyclo[2.2.1]heptane-2-carbonyl]amino]propyl-trimethylazanium is C[N+](C)(C)CCCNC(=O)[C@H]1C[C@H]2CC[C@@H]1C2.
What is the InChIKey of 3-[[(1R,2S,4S)-bicyclo[2.2.1]heptane-2-carbonyl]amino]propyl-trimethylazanium?
The InChIKey is ATPREZXWWGWYMJ-XQQFMLRXSA-O. The full InChI is InChI=1S/C14H26N2O/c1-16(2,3)8-4-7-15-14(17)13-10-11-5-6-12(13)9-11/h11-13H,4-10H2,1-3H3/p+1/t11-,12+,13-/m0/s1.
What are the key properties of 3-[[(1R,2S,4S)-bicyclo[2.2.1]heptane-2-carbonyl]amino]propyl-trimethylazanium?
3-[[(1R,2S,4S)-bicyclo[2.2.1]heptane-2-carbonyl]amino]propyl-trimethylazanium has a molecular weight of 239.38 g/mol, XLogP of 1.64, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(1R,2S,4S)-bicyclo[2.2.1]heptane-2-carbonyl]amino]propyl-trimethylazanium is sourced from PubChem (CID 6565756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).