C20H21N5OS — CID 6567604
(6S)-3-pentylsulfanyl-6-pyridin-3-yl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 6567604) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is (6S)-3-pentylsulfanyl-6-pyridin-3-yl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | (6S)-3-pentylsulfanyl-6-pyridin-3-yl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 6567604 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (6S)-3-pentylsulfanyl-6-pyridin-3-yl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CCCCCSc1nnc2c(n1)O[C@@H](c1cccnc1)Nc1ccccc1-2 |
| InChI | InChI=1S/C20H21N5OS/c1-2-3-6-12-27-20-23-19-17(24-25-20)15-9-4-5-10-16(15)22-18(26-19)14-8-7-11-21-13-14/h4-5,7-11,13,18,22H,2-3,6,12H2,1H3/t18-/m0/s1 |
| InChIKey | DGAMWLUAPNZHBO-SFHVURJKSA-N |
| XLogP | 4.72 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|