C23H22N4O4 — CID 6569103
(1S,9S)-N-[(Z)-2-cyano-3-(4-methoxyphenyl)prop-2-enoyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide (PubChem CID 6569103) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is (1S,9S)-N-[(Z)-2-cyano-3-(4-methoxyphenyl)prop-2-enoyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide.
| Compound Name | (1S,9S)-N-[(Z)-2-cyano-3-(4-methoxyphenyl)prop-2-enoyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide |
|---|---|
| PubChem CID | 6569103 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (1S,9S)-N-[(Z)-2-cyano-3-(4-methoxyphenyl)prop-2-enoyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide |
| SMILES | COc1ccc(/C=C(/C#N)C(=O)NC(=O)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 |
| InChI | InChI=1S/C23H22N4O4/c1-31-19-7-5-15(6-8-19)9-17(11-24)22(29)25-23(30)26-12-16-10-18(14-26)20-3-2-4-21(28)27(20)13-16/h2-9,16,18H,10,12-14H2,1H3,(H,25,29,30)/b17-9-/t16-,18+/m1/s1 |
| InChIKey | GSLQWEJSVRTABJ-FZGFUZEQSA-N |
| XLogP | 2.12 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|