About 2-[3,5-dibromo-4-[4-hydroxy-3-(2-phenylethylcarbamoyl)phenoxy]phenyl]acetic acid
2-[3,5-dibromo-4-[4-hydroxy-3-(2-phenylethylcarbamoyl)phenoxy]phenyl]acetic acid (PubChem CID 656928) has the molecular formula C23H19Br2NO5
and a molecular weight of 549.22 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-[4-hydroxy-3-(2-phenylethylcarbamoyl)phenoxy]phenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[3,5-dibromo-4-[4-hydroxy-3-(2-phenylethylcarbamoyl)phenoxy]phenyl]acetic acid |
| PubChem CID | 656928 |
| Molecular Formula | C23H19Br2NO5 |
| Molecular Weight | 549.22 g/mol |
| Exact Mass | 546.96 |
| IUPAC Name | 2-[3,5-dibromo-4-[4-hydroxy-3-(2-phenylethylcarbamoyl)phenoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cc(Br)c(Oc2ccc(O)c(C(=O)NCCc3ccccc3)c2)c(Br)c1 |
| InChI | InChI=1S/C23H19Br2NO5/c24-18-10-15(12-21(28)29)11-19(25)22(18)31-16-6-7-20(27)17(13-16)23(30)26-9-8-14-4-2-1-3-5-14/h1-7,10-11,13,27H,8-9,12H2,(H,26,30)(H,28,29) |
| InChIKey | UMGUSXFHBSNVGH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 549.22 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3,5-dibromo-4-[4-hydroxy-3-(2-phenylethylcarbamoyl)phenoxy]phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-dibromo-4-[4-hydroxy-3-(2-phenylethylcarbamoyl)phenoxy]phenyl]acetic acid?
The IUPAC name of 2-[3,5-dibromo-4-[4-hydroxy-3-(2-phenylethylcarbamoyl)phenoxy]phenyl]acetic acid (CID 656928) is 2-[3,5-dibromo-4-[4-hydroxy-3-(2-phenylethylcarbamoyl)phenoxy]phenyl]acetic acid.
What is the SMILES notation for 2-[3,5-dibromo-4-[4-hydroxy-3-(2-phenylethylcarbamoyl)phenoxy]phenyl]acetic acid?
The canonical SMILES for 2-[3,5-dibromo-4-[4-hydroxy-3-(2-phenylethylcarbamoyl)phenoxy]phenyl]acetic acid is O=C(O)Cc1cc(Br)c(Oc2ccc(O)c(C(=O)NCCc3ccccc3)c2)c(Br)c1.
What is the InChIKey of 2-[3,5-dibromo-4-[4-hydroxy-3-(2-phenylethylcarbamoyl)phenoxy]phenyl]acetic acid?
The InChIKey is UMGUSXFHBSNVGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19Br2NO5/c24-18-10-15(12-21(28)29)11-19(25)22(18)31-16-6-7-20(27)17(13-16)23(30)26-9-8-14-4-2-1-3-5-14/h1-7,10-11,13,27H,8-9,12H2,(H,26,30)(H,28,29).
What are the key properties of 2-[3,5-dibromo-4-[4-hydroxy-3-(2-phenylethylcarbamoyl)phenoxy]phenyl]acetic acid?
2-[3,5-dibromo-4-[4-hydroxy-3-(2-phenylethylcarbamoyl)phenoxy]phenyl]acetic acid has a molecular weight of 549.22 g/mol, XLogP of 5.31, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-dibromo-4-[4-hydroxy-3-(2-phenylethylcarbamoyl)phenoxy]phenyl]acetic acid is sourced from PubChem (CID 656928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).