C23H22FN3O2 — CID 6570642
(2S)-4-[2-(4-fluorophenyl)ethyl]-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione (PubChem CID 6570642) has the molecular formula C23H22FN3O2 and a molecular weight of 391.45 g/mol. Its IUPAC name is (2S)-4-[2-(4-fluorophenyl)ethyl]-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione.
| Compound Name | (2S)-4-[2-(4-fluorophenyl)ethyl]-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione |
|---|---|
| PubChem CID | 6570642 |
| Molecular Formula | C23H22FN3O2 |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (2S)-4-[2-(4-fluorophenyl)ethyl]-2-methyl-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-3,6-dione |
| SMILES | C[C@]12C(=O)N(CCc3ccc(F)cc3)CC(=O)N1CCc1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C23H22FN3O2/c1-23-21-18(17-4-2-3-5-19(17)25-21)11-13-27(23)20(28)14-26(22(23)29)12-10-15-6-8-16(24)9-7-15/h2-9,25H,10-14H2,1H3/t23-/m0/s1 |
| InChIKey | NRPLWSITAUONDR-QHCPKHFHSA-N |
| XLogP | 2.99 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |