C15H20N2O5S — CID 6570861
(3S,5S,8R)-3-(2-amino-1,3-thiazol-4-yl)-3-methyl-8-(propoxymethyl)-2,7-dioxaspiro[4.4]nonane-1,6-dione (PubChem CID 6570861) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is (3S,5S,8R)-3-(2-amino-1,3-thiazol-4-yl)-3-methyl-8-(propoxymethyl)-2,7-dioxaspiro[4.4]nonane-1,6-dione.
| Compound Name | (3S,5S,8R)-3-(2-amino-1,3-thiazol-4-yl)-3-methyl-8-(propoxymethyl)-2,7-dioxaspiro[4.4]nonane-1,6-dione |
|---|---|
| PubChem CID | 6570861 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | (3S,5S,8R)-3-(2-amino-1,3-thiazol-4-yl)-3-methyl-8-(propoxymethyl)-2,7-dioxaspiro[4.4]nonane-1,6-dione |
| SMILES | CCCOC[C@H]1C[C@]2(C[C@@](C)(c3csc(N)n3)OC2=O)C(=O)O1 |
| InChI | InChI=1S/C15H20N2O5S/c1-3-4-20-6-9-5-15(11(18)21-9)8-14(2,22-12(15)19)10-7-23-13(16)17-10/h7,9H,3-6,8H2,1-2H3,(H2,16,17)/t9-,14+,15+/m1/s1 |
| InChIKey | UVBVHSSYOFXGJL-NKZPBKNFSA-N |
| XLogP | 1.62 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|