C17H22O — CID 6571901
(1R,8R,11S,13R)-1,10,10-trimethyl-9-oxatetracyclo[9.2.2.02,7.08,13]pentadeca-2,4,6-triene (PubChem CID 6571901) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is (1R,8R,11S,13R)-1,10,10-trimethyl-9-oxatetracyclo[9.2.2.02,7.08,13]pentadeca-2,4,6-triene.
| Compound Name | (1R,8R,11S,13R)-1,10,10-trimethyl-9-oxatetracyclo[9.2.2.02,7.08,13]pentadeca-2,4,6-triene |
|---|---|
| PubChem CID | 6571901 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (1R,8R,11S,13R)-1,10,10-trimethyl-9-oxatetracyclo[9.2.2.02,7.08,13]pentadeca-2,4,6-triene |
| SMILES | CC1(C)O[C@H]2c3ccccc3[C@]3(C)CC[C@H]1C[C@@H]23 |
| InChI | InChI=1S/C17H22O/c1-16(2)11-8-9-17(3)13-7-5-4-6-12(13)15(18-16)14(17)10-11/h4-7,11,14-15H,8-10H2,1-3H3/t11-,14-,15-,17-/m0/s1 |
| InChIKey | IKOLIGYNXYWECM-SIUGBPQLSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |