About 2-hydroxypropanenitrile
2-hydroxypropanenitrile (PubChem CID 6572) has the molecular formula C3H5NO
and a molecular weight of 71.08 g/mol. Its IUPAC name is 2-hydroxypropanenitrile.
Molecular Properties
| Compound Name | 2-hydroxypropanenitrile |
| PubChem CID | 6572 |
| Molecular Formula | C3H5NO |
| Molecular Weight | 71.08 g/mol |
| Exact Mass | 71.04 |
| IUPAC Name | 2-hydroxypropanenitrile |
| SMILES | CC(O)C#N |
| InChI | InChI=1S/C3H5NO/c1-3(5)2-4/h3,5H,1H3 |
| InChIKey | WOFDVDFSGLBFAC-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 71.08 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanenitrile?
The IUPAC name of 2-hydroxypropanenitrile (CID 6572) is 2-hydroxypropanenitrile.
What is the SMILES notation for 2-hydroxypropanenitrile?
The canonical SMILES for 2-hydroxypropanenitrile is CC(O)C#N.
What is the InChIKey of 2-hydroxypropanenitrile?
The InChIKey is WOFDVDFSGLBFAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO/c1-3(5)2-4/h3,5H,1H3.
What are the key properties of 2-hydroxypropanenitrile?
2-hydroxypropanenitrile has a molecular weight of 71.08 g/mol, XLogP of -0.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanenitrile is sourced from PubChem (CID 6572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).