C26H38N2O3+2 — CID 6572162
(1R,3S,4R,5S,8R,10R,14S)-5-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one (PubChem CID 6572162) has the molecular formula C26H38N2O3+2 and a molecular weight of 426.60 g/mol. Its IUPAC name is (1R,3S,4R,5S,8R,10R,14S)-5-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one.
| Compound Name | (1R,3S,4R,5S,8R,10R,14S)-5-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
|---|---|
| PubChem CID | 6572162 |
| Molecular Formula | C26H38N2O3+2 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | (1R,3S,4R,5S,8R,10R,14S)-5-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
| SMILES | C[C@H]1CCC[C@]2(C)C[C@H]3OC(=O)[C@H](C[NH+]4CC[NH+](Cc5ccccc5)CC4)[C@H]3[C@@H]3O[C@@]132 |
| InChI | InChI=1S/C26H36N2O3/c1-18-7-6-10-25(2)15-21-22(23-26(18,25)31-23)20(24(29)30-21)17-28-13-11-27(12-14-28)16-19-8-4-3-5-9-19/h3-5,8-9,18,20-23H,6-7,10-17H2,1-2H3/p+2/t18-,20+,21+,22+,23-,25+,26-/m0/s1 |
| InChIKey | KCIBTQFWUYJMPS-RXUMLTCKSA-P |
| XLogP | 0.50 |
| TPSA | 47.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|