C9H18O5S2 — CID 6572336
(1R,2R,3R,4R)-1-(1,3-dithian-2-yl)pentane-1,2,3,4,5-pentol (PubChem CID 6572336) has the molecular formula C9H18O5S2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (1R,2R,3R,4R)-1-(1,3-dithian-2-yl)pentane-1,2,3,4,5-pentol.
| Compound Name | (1R,2R,3R,4R)-1-(1,3-dithian-2-yl)pentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 6572336 |
| Molecular Formula | C9H18O5S2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | (1R,2R,3R,4R)-1-(1,3-dithian-2-yl)pentane-1,2,3,4,5-pentol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)C1SCCCS1 |
| InChI | InChI=1S/C9H18O5S2/c10-4-5(11)6(12)7(13)8(14)9-15-2-1-3-16-9/h5-14H,1-4H2/t5-,6-,7-,8-/m1/s1 |
| InChIKey | JDZPNIUYDWENDQ-WCTZXXKLSA-N |
| XLogP | -1.38 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |