C31H34N2O5 — CID 6573057
N-[(7S)-1,2,3-trimethoxy-9-oxo-10-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide (PubChem CID 6573057) has the molecular formula C31H34N2O5 and a molecular weight of 514.62 g/mol. Its IUPAC name is N-[(7S)-1,2,3-trimethoxy-9-oxo-10-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide.
| Compound Name | N-[(7S)-1,2,3-trimethoxy-9-oxo-10-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
|---|---|
| PubChem CID | 6573057 |
| Molecular Formula | C31H34N2O5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | N-[(7S)-1,2,3-trimethoxy-9-oxo-10-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(N[C@H]3CCCc4ccccc43)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C31H34N2O5/c1-18(34)32-25-14-12-20-16-28(36-2)30(37-3)31(38-4)29(20)22-13-15-26(27(35)17-23(22)25)33-24-11-7-9-19-8-5-6-10-21(19)24/h5-6,8,10,13,15-17,24-25H,7,9,11-12,14H2,1-4H3,(H,32,34)(H,33,35)/t24-,25-/m0/s1 |
| InChIKey | LWLVWAGXBPJMRS-DQEYMECFSA-N |
| XLogP | 5.35 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |