About trimethyl-[[(2S,4R)-2-methyl-1,3-dioxolan-4-yl]methyl]azanium
trimethyl-[[(2S,4R)-2-methyl-1,3-dioxolan-4-yl]methyl]azanium (PubChem CID 657347) has the molecular formula C8H18NO2+
and a molecular weight of 160.24 g/mol. Its IUPAC name is trimethyl-[[(2S,4R)-2-methyl-1,3-dioxolan-4-yl]methyl]azanium.
Molecular Properties
| Compound Name | trimethyl-[[(2S,4R)-2-methyl-1,3-dioxolan-4-yl]methyl]azanium |
| PubChem CID | 657347 |
| Molecular Formula | C8H18NO2+ |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | trimethyl-[[(2S,4R)-2-methyl-1,3-dioxolan-4-yl]methyl]azanium |
| SMILES | C[C@H]1OC[C@@H](C[N+](C)(C)C)O1 |
| InChI | InChI=1S/C8H18NO2/c1-7-10-6-8(11-7)5-9(2,3)4/h7-8H,5-6H2,1-4H3/q+1/t7-,8+/m0/s1 |
| InChIKey | COSSAOQSSXDIQW-JGVFFNPUSA-N |
| XLogP | 0.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[[(2S,4R)-2-methyl-1,3-dioxolan-4-yl]methyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[[(2S,4R)-2-methyl-1,3-dioxolan-4-yl]methyl]azanium?
The IUPAC name of trimethyl-[[(2S,4R)-2-methyl-1,3-dioxolan-4-yl]methyl]azanium (CID 657347) is trimethyl-[[(2S,4R)-2-methyl-1,3-dioxolan-4-yl]methyl]azanium.
What is the SMILES notation for trimethyl-[[(2S,4R)-2-methyl-1,3-dioxolan-4-yl]methyl]azanium?
The canonical SMILES for trimethyl-[[(2S,4R)-2-methyl-1,3-dioxolan-4-yl]methyl]azanium is C[C@H]1OC[C@@H](C[N+](C)(C)C)O1.
What is the InChIKey of trimethyl-[[(2S,4R)-2-methyl-1,3-dioxolan-4-yl]methyl]azanium?
The InChIKey is COSSAOQSSXDIQW-JGVFFNPUSA-N. The full InChI is InChI=1S/C8H18NO2/c1-7-10-6-8(11-7)5-9(2,3)4/h7-8H,5-6H2,1-4H3/q+1/t7-,8+/m0/s1.
What are the key properties of trimethyl-[[(2S,4R)-2-methyl-1,3-dioxolan-4-yl]methyl]azanium?
trimethyl-[[(2S,4R)-2-methyl-1,3-dioxolan-4-yl]methyl]azanium has a molecular weight of 160.24 g/mol, XLogP of 0.45, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[[(2S,4R)-2-methyl-1,3-dioxolan-4-yl]methyl]azanium is sourced from PubChem (CID 657347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).