About N-[(1S,2R)-2-phenylcyclopropyl]acetamide
N-[(1S,2R)-2-phenylcyclopropyl]acetamide (PubChem CID 657469) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is N-[(1S,2R)-2-phenylcyclopropyl]acetamide.
Molecular Properties
| Compound Name | N-[(1S,2R)-2-phenylcyclopropyl]acetamide |
| PubChem CID | 657469 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | N-[(1S,2R)-2-phenylcyclopropyl]acetamide |
| SMILES | CC(=O)N[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C11H13NO/c1-8(13)12-11-7-10(11)9-5-3-2-4-6-9/h2-6,10-11H,7H2,1H3,(H,12,13)/t10-,11+/m1/s1 |
| InChIKey | OKNYZIGDRLPEEJ-MNOVXSKESA-N |
| XLogP | 1.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(1S,2R)-2-phenylcyclopropyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,2R)-2-phenylcyclopropyl]acetamide?
The IUPAC name of N-[(1S,2R)-2-phenylcyclopropyl]acetamide (CID 657469) is N-[(1S,2R)-2-phenylcyclopropyl]acetamide.
What is the SMILES notation for N-[(1S,2R)-2-phenylcyclopropyl]acetamide?
The canonical SMILES for N-[(1S,2R)-2-phenylcyclopropyl]acetamide is CC(=O)N[C@H]1C[C@@H]1c1ccccc1.
What is the InChIKey of N-[(1S,2R)-2-phenylcyclopropyl]acetamide?
The InChIKey is OKNYZIGDRLPEEJ-MNOVXSKESA-N. The full InChI is InChI=1S/C11H13NO/c1-8(13)12-11-7-10(11)9-5-3-2-4-6-9/h2-6,10-11H,7H2,1H3,(H,12,13)/t10-,11+/m1/s1.
What are the key properties of N-[(1S,2R)-2-phenylcyclopropyl]acetamide?
N-[(1S,2R)-2-phenylcyclopropyl]acetamide has a molecular weight of 175.23 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,2R)-2-phenylcyclopropyl]acetamide is sourced from PubChem (CID 657469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).