C13H22N8O — CID 657493
2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-dimethylpropanamide (PubChem CID 657493) has the molecular formula C13H22N8O and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-dimethylpropanamide.
| Compound Name | 2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 657493 |
| Molecular Formula | C13H22N8O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-dimethylpropanamide |
| SMILES | CC(C(=O)N(C)C)N(C#N)c1nc(N(C)C)nc(N(C)C)n1 |
| InChI | InChI=1S/C13H22N8O/c1-9(10(22)18(2)3)21(8-14)13-16-11(19(4)5)15-12(17-13)20(6)7/h9H,1-7H3 |
| InChIKey | JIGHSJGKWDHDKE-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 92.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|