C21H19NO2 — CID 657502
1,4-diphenyl-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione (PubChem CID 657502) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 1,4-diphenyl-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione.
| Compound Name | 1,4-diphenyl-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione |
|---|---|
| PubChem CID | 657502 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1,4-diphenyl-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione |
| SMILES | O=C1CCCC2=C1C(c1ccccc1)CC(=O)N2c1ccccc1 |
| InChI | InChI=1S/C21H19NO2/c23-19-13-7-12-18-21(19)17(15-8-3-1-4-9-15)14-20(24)22(18)16-10-5-2-6-11-16/h1-6,8-11,17H,7,12-14H2 |
| InChIKey | OSBAJDNOTYNOIB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |