C23H21NO5 — CID 6575571
benzyl (1S,5S,6R,7R)-3-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 6575571) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is benzyl (1S,5S,6R,7R)-3-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | benzyl (1S,5S,6R,7R)-3-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 6575571 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | benzyl (1S,5S,6R,7R)-3-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | COc1ccc(N2C[C@@]34C=C[C@@H](O3)[C@H](C(=O)OCc3ccccc3)[C@@H]4C2=O)cc1 |
| InChI | InChI=1S/C23H21NO5/c1-27-17-9-7-16(8-10-17)24-14-23-12-11-18(29-23)19(20(23)21(24)25)22(26)28-13-15-5-3-2-4-6-15/h2-12,18-20H,13-14H2,1H3/t18-,19+,20-,23-/m1/s1 |
| InChIKey | FGCRNGIMEMHLIU-VLVHOKLOSA-N |
| XLogP | 2.72 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|