C22H22N6O2 — CID 657576
tert-butyl (8S,8aR)-6-amino-5,7,7-tricyano-8-pyridin-3-yl-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate (PubChem CID 657576) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is tert-butyl (8S,8aR)-6-amino-5,7,7-tricyano-8-pyridin-3-yl-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate.
| Compound Name | tert-butyl (8S,8aR)-6-amino-5,7,7-tricyano-8-pyridin-3-yl-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 657576 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | tert-butyl (8S,8aR)-6-amino-5,7,7-tricyano-8-pyridin-3-yl-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C2C(C#N)=C(N)C(C#N)(C#N)[C@H](c3cccnc3)[C@H]2C1 |
| InChI | InChI=1S/C22H22N6O2/c1-21(2,3)30-20(29)28-8-6-15-16(9-23)19(26)22(12-24,13-25)18(17(15)11-28)14-5-4-7-27-10-14/h4-7,10,17-18H,8,11,26H2,1-3H3/t17-,18+/m0/s1 |
| InChIKey | RQEJNDVQCMTJEN-ZWKOTPCHSA-N |
| XLogP | 2.74 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|