About [(2S)-5-acetyloxy-8-(3-methylbut-2-enyl)-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] acetate
[(2S)-5-acetyloxy-8-(3-methylbut-2-enyl)-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] acetate (PubChem CID 6575957) has the molecular formula C24H24O6
and a molecular weight of 408.45 g/mol. Its IUPAC name is [(2S)-5-acetyloxy-8-(3-methylbut-2-enyl)-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] acetate.
Molecular Properties
| Compound Name | [(2S)-5-acetyloxy-8-(3-methylbut-2-enyl)-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] acetate |
| PubChem CID | 6575957 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | [(2S)-5-acetyloxy-8-(3-methylbut-2-enyl)-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] acetate |
| SMILES | CC(=O)Oc1cc(OC(C)=O)c2c(c1CC=C(C)C)O[C@H](c1ccccc1)CC2=O |
| InChI | InChI=1S/C24H24O6/c1-14(2)10-11-18-21(28-15(3)25)13-22(29-16(4)26)23-19(27)12-20(30-24(18)23)17-8-6-5-7-9-17/h5-10,13,20H,11-12H2,1-4H3/t20-/m0/s1 |
| InChIKey | ZWTXAHLNCWXTAY-FQEVSTJZSA-N |
| XLogP | 4.75 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-5-acetyloxy-8-(3-methylbut-2-enyl)-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-5-acetyloxy-8-(3-methylbut-2-enyl)-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] acetate?
The IUPAC name of [(2S)-5-acetyloxy-8-(3-methylbut-2-enyl)-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] acetate (CID 6575957) is [(2S)-5-acetyloxy-8-(3-methylbut-2-enyl)-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] acetate.
What is the SMILES notation for [(2S)-5-acetyloxy-8-(3-methylbut-2-enyl)-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] acetate?
The canonical SMILES for [(2S)-5-acetyloxy-8-(3-methylbut-2-enyl)-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] acetate is CC(=O)Oc1cc(OC(C)=O)c2c(c1CC=C(C)C)O[C@H](c1ccccc1)CC2=O.
What is the InChIKey of [(2S)-5-acetyloxy-8-(3-methylbut-2-enyl)-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] acetate?
The InChIKey is ZWTXAHLNCWXTAY-FQEVSTJZSA-N. The full InChI is InChI=1S/C24H24O6/c1-14(2)10-11-18-21(28-15(3)25)13-22(29-16(4)26)23-19(27)12-20(30-24(18)23)17-8-6-5-7-9-17/h5-10,13,20H,11-12H2,1-4H3/t20-/m0/s1.
What are the key properties of [(2S)-5-acetyloxy-8-(3-methylbut-2-enyl)-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] acetate?
[(2S)-5-acetyloxy-8-(3-methylbut-2-enyl)-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] acetate has a molecular weight of 408.45 g/mol, XLogP of 4.75, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-5-acetyloxy-8-(3-methylbut-2-enyl)-4-oxo-2-phenyl-2,3-dihydrochromen-7-yl] acetate is sourced from PubChem (CID 6575957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).