C28H36N2O4 — CID 657625
2,5-bis(morpholin-4-ylmethyl)-1,6-diphenylhexane-1,6-dione (PubChem CID 657625) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is 2,5-bis(morpholin-4-ylmethyl)-1,6-diphenylhexane-1,6-dione.
| Compound Name | 2,5-bis(morpholin-4-ylmethyl)-1,6-diphenylhexane-1,6-dione |
|---|---|
| PubChem CID | 657625 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 2,5-bis(morpholin-4-ylmethyl)-1,6-diphenylhexane-1,6-dione |
| SMILES | O=C(c1ccccc1)C(CCC(CN1CCOCC1)C(=O)c1ccccc1)CN1CCOCC1 |
| InChI | InChI=1S/C28H36N2O4/c31-27(23-7-3-1-4-8-23)25(21-29-13-17-33-18-14-29)11-12-26(22-30-15-19-34-20-16-30)28(32)24-9-5-2-6-10-24/h1-10,25-26H,11-22H2 |
| InChIKey | CVOBZFLICCGWKJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |