C18H22BrNO2 — CID 6576836
(1R,2S,4R)-2-bromo-N,4,7,7-tetramethyl-3-oxo-N-phenylbicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 6576836) has the molecular formula C18H22BrNO2 and a molecular weight of 364.28 g/mol. Its IUPAC name is (1R,2S,4R)-2-bromo-N,4,7,7-tetramethyl-3-oxo-N-phenylbicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1R,2S,4R)-2-bromo-N,4,7,7-tetramethyl-3-oxo-N-phenylbicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 6576836 |
| Molecular Formula | C18H22BrNO2 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | (1R,2S,4R)-2-bromo-N,4,7,7-tetramethyl-3-oxo-N-phenylbicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CN(C(=O)[C@]12CC[C@@](C)(C(=O)[C@H]1Br)C2(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H22BrNO2/c1-16(2)17(3)10-11-18(16,13(19)14(17)21)15(22)20(4)12-8-6-5-7-9-12/h5-9,13H,10-11H2,1-4H3/t13-,17+,18+/m1/s1 |
| InChIKey | FTAAUGWQDXBZLU-BVGQSLNGSA-N |
| XLogP | 3.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|