C12H21N9 — CID 657693
2-N-methyl-4-N,6-N-di(propan-2-yl)-2-N-(1,2,4-triazol-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 657693) has the molecular formula C12H21N9 and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-N-methyl-4-N,6-N-di(propan-2-yl)-2-N-(1,2,4-triazol-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-methyl-4-N,6-N-di(propan-2-yl)-2-N-(1,2,4-triazol-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 657693 |
| Molecular Formula | C12H21N9 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 2-N-methyl-4-N,6-N-di(propan-2-yl)-2-N-(1,2,4-triazol-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC(C)Nc1nc(NC(C)C)nc(N(C)n2cnnc2)n1 |
| InChI | InChI=1S/C12H21N9/c1-8(2)15-10-17-11(16-9(3)4)19-12(18-10)20(5)21-6-13-14-7-21/h6-9H,1-5H3,(H2,15,16,17,18,19) |
| InChIKey | MLMUDYHPPDQANN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |