C15H24N3O3S+ — CID 6576966
N-[(2S)-1-(4-methylpiperazin-4-ium-1-yl)-1-oxopropan-2-yl]-N-phenylmethanesulfonamide (PubChem CID 6576966) has the molecular formula C15H24N3O3S+ and a molecular weight of 326.44 g/mol. Its IUPAC name is N-[(2S)-1-(4-methylpiperazin-4-ium-1-yl)-1-oxopropan-2-yl]-N-phenylmethanesulfonamide.
| Compound Name | N-[(2S)-1-(4-methylpiperazin-4-ium-1-yl)-1-oxopropan-2-yl]-N-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 6576966 |
| Molecular Formula | C15H24N3O3S+ |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N-[(2S)-1-(4-methylpiperazin-4-ium-1-yl)-1-oxopropan-2-yl]-N-phenylmethanesulfonamide |
| SMILES | C[C@@H](C(=O)N1CC[NH+](C)CC1)N(c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C15H23N3O3S/c1-13(15(19)17-11-9-16(2)10-12-17)18(22(3,20)21)14-7-5-4-6-8-14/h4-8,13H,9-12H2,1-3H3/p+1/t13-/m0/s1 |
| InChIKey | RRGDQWWOIMSXPY-ZDUSSCGKSA-O |
| XLogP | -0.80 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |