About N-(2-hydroxyethyl)-N'-(4-phenoxyphenyl)butanediamide
N-(2-hydroxyethyl)-N'-(4-phenoxyphenyl)butanediamide (PubChem CID 657700) has the molecular formula C18H20N2O4
and a molecular weight of 328.37 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N'-(4-phenoxyphenyl)butanediamide.
Molecular Properties
| Compound Name | N-(2-hydroxyethyl)-N'-(4-phenoxyphenyl)butanediamide |
| PubChem CID | 657700 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-(2-hydroxyethyl)-N'-(4-phenoxyphenyl)butanediamide |
| SMILES | O=C(CCC(=O)Nc1ccc(Oc2ccccc2)cc1)NCCO |
| InChI | InChI=1S/C18H20N2O4/c21-13-12-19-17(22)10-11-18(23)20-14-6-8-16(9-7-14)24-15-4-2-1-3-5-15/h1-9,21H,10-13H2,(H,19,22)(H,20,23) |
| InChIKey | WZISUNKURUPGDW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-hydroxyethyl)-N'-(4-phenoxyphenyl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyethyl)-N'-(4-phenoxyphenyl)butanediamide?
The IUPAC name of N-(2-hydroxyethyl)-N'-(4-phenoxyphenyl)butanediamide (CID 657700) is N-(2-hydroxyethyl)-N'-(4-phenoxyphenyl)butanediamide.
What is the SMILES notation for N-(2-hydroxyethyl)-N'-(4-phenoxyphenyl)butanediamide?
The canonical SMILES for N-(2-hydroxyethyl)-N'-(4-phenoxyphenyl)butanediamide is O=C(CCC(=O)Nc1ccc(Oc2ccccc2)cc1)NCCO.
What is the InChIKey of N-(2-hydroxyethyl)-N'-(4-phenoxyphenyl)butanediamide?
The InChIKey is WZISUNKURUPGDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O4/c21-13-12-19-17(22)10-11-18(23)20-14-6-8-16(9-7-14)24-15-4-2-1-3-5-15/h1-9,21H,10-13H2,(H,19,22)(H,20,23).
What are the key properties of N-(2-hydroxyethyl)-N'-(4-phenoxyphenyl)butanediamide?
N-(2-hydroxyethyl)-N'-(4-phenoxyphenyl)butanediamide has a molecular weight of 328.37 g/mol, XLogP of 2.31, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyethyl)-N'-(4-phenoxyphenyl)butanediamide is sourced from PubChem (CID 657700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).