C34H33NO3 — CID 6577124
(1S,2R,6R,7R)-1,7-diethyl-8,9-diphenyl-4-(2,4,6-trimethylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 6577124) has the molecular formula C34H33NO3 and a molecular weight of 503.64 g/mol. Its IUPAC name is (1S,2R,6R,7R)-1,7-diethyl-8,9-diphenyl-4-(2,4,6-trimethylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | (1S,2R,6R,7R)-1,7-diethyl-8,9-diphenyl-4-(2,4,6-trimethylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 6577124 |
| Molecular Formula | C34H33NO3 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | (1S,2R,6R,7R)-1,7-diethyl-8,9-diphenyl-4-(2,4,6-trimethylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | CC[C@]12C(=O)[C@](CC)(C(c3ccccc3)=C1c1ccccc1)[C@@H]1C(=O)N(c3c(C)cc(C)cc3C)C(=O)[C@H]12 |
| InChI | InChI=1S/C34H33NO3/c1-6-33-25(23-14-10-8-11-15-23)26(24-16-12-9-13-17-24)34(7-2,32(33)38)28-27(33)30(36)35(31(28)37)29-21(4)18-20(3)19-22(29)5/h8-19,27-28H,6-7H2,1-5H3/t27-,28-,33-,34+/m0/s1 |
| InChIKey | YFTDNFJXVSGFGS-IFYYNRDRSA-N |
| XLogP | 6.72 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|