About 5-[2-(methylamino)ethyl]-1H-1,2,4-triazol-3-amine
5-[2-(methylamino)ethyl]-1H-1,2,4-triazol-3-amine (PubChem CID 657726) has the molecular formula C5H11N5
and a molecular weight of 141.18 g/mol. Its IUPAC name is 5-[2-(methylamino)ethyl]-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-[2-(methylamino)ethyl]-1H-1,2,4-triazol-3-amine |
| PubChem CID | 657726 |
| Molecular Formula | C5H11N5 |
| Molecular Weight | 141.18 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 5-[2-(methylamino)ethyl]-1H-1,2,4-triazol-3-amine |
| SMILES | CNCCc1nc(N)n[nH]1 |
| InChI | InChI=1S/C5H11N5/c1-7-3-2-4-8-5(6)10-9-4/h7H,2-3H2,1H3,(H3,6,8,9,10) |
| InChIKey | KNGTVQOTKFUWKU-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.18 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[2-(methylamino)ethyl]-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(methylamino)ethyl]-1H-1,2,4-triazol-3-amine?
The IUPAC name of 5-[2-(methylamino)ethyl]-1H-1,2,4-triazol-3-amine (CID 657726) is 5-[2-(methylamino)ethyl]-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-[2-(methylamino)ethyl]-1H-1,2,4-triazol-3-amine?
The canonical SMILES for 5-[2-(methylamino)ethyl]-1H-1,2,4-triazol-3-amine is CNCCc1nc(N)n[nH]1.
What is the InChIKey of 5-[2-(methylamino)ethyl]-1H-1,2,4-triazol-3-amine?
The InChIKey is KNGTVQOTKFUWKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N5/c1-7-3-2-4-8-5(6)10-9-4/h7H,2-3H2,1H3,(H3,6,8,9,10).
What are the key properties of 5-[2-(methylamino)ethyl]-1H-1,2,4-triazol-3-amine?
5-[2-(methylamino)ethyl]-1H-1,2,4-triazol-3-amine has a molecular weight of 141.18 g/mol, XLogP of -0.85, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(methylamino)ethyl]-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 657726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).