About 3-bromo-2-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole
3-bromo-2-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (PubChem CID 657731) has the molecular formula C13H13BrN2O
and a molecular weight of 293.16 g/mol. Its IUPAC name is 3-bromo-2-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
Molecular Properties
| Compound Name | 3-bromo-2-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| PubChem CID | 657731 |
| Molecular Formula | C13H13BrN2O |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 3-bromo-2-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| SMILES | COc1ccc(-c2nc3n(c2Br)CCC3)cc1 |
| InChI | InChI=1S/C13H13BrN2O/c1-17-10-6-4-9(5-7-10)12-13(14)16-8-2-3-11(16)15-12/h4-7H,2-3,8H2,1H3 |
| InChIKey | UQKXSDIJXQMRLG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-2-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The IUPAC name of 3-bromo-2-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (CID 657731) is 3-bromo-2-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
What is the SMILES notation for 3-bromo-2-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The canonical SMILES for 3-bromo-2-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is COc1ccc(-c2nc3n(c2Br)CCC3)cc1.
What is the InChIKey of 3-bromo-2-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The InChIKey is UQKXSDIJXQMRLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrN2O/c1-17-10-6-4-9(5-7-10)12-13(14)16-8-2-3-11(16)15-12/h4-7H,2-3,8H2,1H3.
What are the key properties of 3-bromo-2-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
3-bromo-2-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole has a molecular weight of 293.16 g/mol, XLogP of 3.27, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is sourced from PubChem (CID 657731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).