About 8-oxo-10,11-dihydro-9H-azepino[1,2-a]quinoline-7-carbonitrile
8-oxo-10,11-dihydro-9H-azepino[1,2-a]quinoline-7-carbonitrile (PubChem CID 657808) has the molecular formula C15H12N2O
and a molecular weight of 236.27 g/mol. Its IUPAC name is 8-oxo-10,11-dihydro-9H-azepino[1,2-a]quinoline-7-carbonitrile.
Molecular Properties
| Compound Name | 8-oxo-10,11-dihydro-9H-azepino[1,2-a]quinoline-7-carbonitrile |
| PubChem CID | 657808 |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 8-oxo-10,11-dihydro-9H-azepino[1,2-a]quinoline-7-carbonitrile |
| SMILES | N#CC1=C2C=Cc3ccccc3N2CCCC1=O |
| InChI | InChI=1S/C15H12N2O/c16-10-12-14-8-7-11-4-1-2-5-13(11)17(14)9-3-6-15(12)18/h1-2,4-5,7-8H,3,6,9H2 |
| InChIKey | CFYYDILZUCNCFM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-oxo-10,11-dihydro-9H-azepino[1,2-a]quinoline-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxo-10,11-dihydro-9H-azepino[1,2-a]quinoline-7-carbonitrile?
The IUPAC name of 8-oxo-10,11-dihydro-9H-azepino[1,2-a]quinoline-7-carbonitrile (CID 657808) is 8-oxo-10,11-dihydro-9H-azepino[1,2-a]quinoline-7-carbonitrile.
What is the SMILES notation for 8-oxo-10,11-dihydro-9H-azepino[1,2-a]quinoline-7-carbonitrile?
The canonical SMILES for 8-oxo-10,11-dihydro-9H-azepino[1,2-a]quinoline-7-carbonitrile is N#CC1=C2C=Cc3ccccc3N2CCCC1=O.
What is the InChIKey of 8-oxo-10,11-dihydro-9H-azepino[1,2-a]quinoline-7-carbonitrile?
The InChIKey is CFYYDILZUCNCFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O/c16-10-12-14-8-7-11-4-1-2-5-13(11)17(14)9-3-6-15(12)18/h1-2,4-5,7-8H,3,6,9H2.
What are the key properties of 8-oxo-10,11-dihydro-9H-azepino[1,2-a]quinoline-7-carbonitrile?
8-oxo-10,11-dihydro-9H-azepino[1,2-a]quinoline-7-carbonitrile has a molecular weight of 236.27 g/mol, XLogP of 2.66, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxo-10,11-dihydro-9H-azepino[1,2-a]quinoline-7-carbonitrile is sourced from PubChem (CID 657808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).