C24H31N3O4 — CID 6578442
N-[(1R)-1-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethyl]-6-methoxy-2,2,4-trimethylquinoline-1-carboxamide (PubChem CID 6578442) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[(1R)-1-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethyl]-6-methoxy-2,2,4-trimethylquinoline-1-carboxamide.
| Compound Name | N-[(1R)-1-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethyl]-6-methoxy-2,2,4-trimethylquinoline-1-carboxamide |
|---|---|
| PubChem CID | 6578442 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | N-[(1R)-1-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]ethyl]-6-methoxy-2,2,4-trimethylquinoline-1-carboxamide |
| SMILES | COc1ccc2c(c1)C(C)=CC(C)(C)N2C(=O)N[C@@H](C)N1C(=O)[C@H]2CCCC[C@@H]2C1=O |
| InChI | InChI=1S/C24H31N3O4/c1-14-13-24(3,4)27(20-11-10-16(31-5)12-19(14)20)23(30)25-15(2)26-21(28)17-8-6-7-9-18(17)22(26)29/h10-13,15,17-18H,6-9H2,1-5H3,(H,25,30)/t15-,17+,18+/m1/s1 |
| InChIKey | GQKYRYULAUMKPA-NJAFHUGGSA-N |
| XLogP | 3.93 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|