About (2S)-2-[[(3S)-1,1-dioxothiolan-3-yl]azaniumyl]propanoate
(2S)-2-[[(3S)-1,1-dioxothiolan-3-yl]azaniumyl]propanoate (PubChem CID 6578558) has the molecular formula C7H13NO4S
and a molecular weight of 207.25 g/mol. Its IUPAC name is (2S)-2-[[(3S)-1,1-dioxothiolan-3-yl]azaniumyl]propanoate.
Molecular Properties
| Compound Name | (2S)-2-[[(3S)-1,1-dioxothiolan-3-yl]azaniumyl]propanoate |
| PubChem CID | 6578558 |
| Molecular Formula | C7H13NO4S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | (2S)-2-[[(3S)-1,1-dioxothiolan-3-yl]azaniumyl]propanoate |
| SMILES | C[C@H]([NH2+][C@H]1CCS(=O)(=O)C1)C(=O)[O-] |
| InChI | InChI=1S/C7H13NO4S/c1-5(7(9)10)8-6-2-3-13(11,12)4-6/h5-6,8H,2-4H2,1H3,(H,9,10)/t5-,6-/m0/s1 |
| InChIKey | RIBCAVCPRSRWDL-WDSKDSINSA-N |
| XLogP | -3.12 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-[[(3S)-1,1-dioxothiolan-3-yl]azaniumyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[(3S)-1,1-dioxothiolan-3-yl]azaniumyl]propanoate?
The IUPAC name of (2S)-2-[[(3S)-1,1-dioxothiolan-3-yl]azaniumyl]propanoate (CID 6578558) is (2S)-2-[[(3S)-1,1-dioxothiolan-3-yl]azaniumyl]propanoate.
What is the SMILES notation for (2S)-2-[[(3S)-1,1-dioxothiolan-3-yl]azaniumyl]propanoate?
The canonical SMILES for (2S)-2-[[(3S)-1,1-dioxothiolan-3-yl]azaniumyl]propanoate is C[C@H]([NH2+][C@H]1CCS(=O)(=O)C1)C(=O)[O-].
What is the InChIKey of (2S)-2-[[(3S)-1,1-dioxothiolan-3-yl]azaniumyl]propanoate?
The InChIKey is RIBCAVCPRSRWDL-WDSKDSINSA-N. The full InChI is InChI=1S/C7H13NO4S/c1-5(7(9)10)8-6-2-3-13(11,12)4-6/h5-6,8H,2-4H2,1H3,(H,9,10)/t5-,6-/m0/s1.
What are the key properties of (2S)-2-[[(3S)-1,1-dioxothiolan-3-yl]azaniumyl]propanoate?
(2S)-2-[[(3S)-1,1-dioxothiolan-3-yl]azaniumyl]propanoate has a molecular weight of 207.25 g/mol, XLogP of -3.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[(3S)-1,1-dioxothiolan-3-yl]azaniumyl]propanoate is sourced from PubChem (CID 6578558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).