C18H20N4O2 — CID 6578670
methyl (2S)-2-cyano-2-[3-[(3S)-3-methylpiperidin-1-yl]quinoxalin-2-yl]acetate (PubChem CID 6578670) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is methyl (2S)-2-cyano-2-[3-[(3S)-3-methylpiperidin-1-yl]quinoxalin-2-yl]acetate.
| Compound Name | methyl (2S)-2-cyano-2-[3-[(3S)-3-methylpiperidin-1-yl]quinoxalin-2-yl]acetate |
|---|---|
| PubChem CID | 6578670 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | methyl (2S)-2-cyano-2-[3-[(3S)-3-methylpiperidin-1-yl]quinoxalin-2-yl]acetate |
| SMILES | COC(=O)[C@H](C#N)c1nc2ccccc2nc1N1CCC[C@H](C)C1 |
| InChI | InChI=1S/C18H20N4O2/c1-12-6-5-9-22(11-12)17-16(13(10-19)18(23)24-2)20-14-7-3-4-8-15(14)21-17/h3-4,7-8,12-13H,5-6,9,11H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | AIMQYEDWNJBUHT-QWHCGFSZSA-N |
| XLogP | 2.65 |
| TPSA | 79.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |