About 1-(furan-2-yl)-N-[2-[(2S,4S)-4-(4-methylphenyl)-2-propan-2-yloxan-4-yl]ethyl]methanimine
1-(furan-2-yl)-N-[2-[(2S,4S)-4-(4-methylphenyl)-2-propan-2-yloxan-4-yl]ethyl]methanimine (PubChem CID 6580000) has the molecular formula C22H29NO2
and a molecular weight of 339.48 g/mol. Its IUPAC name is 1-(furan-2-yl)-N-[2-[(2S,4S)-4-(4-methylphenyl)-2-propan-2-yloxan-4-yl]ethyl]methanimine.
Molecular Properties
| Compound Name | 1-(furan-2-yl)-N-[2-[(2S,4S)-4-(4-methylphenyl)-2-propan-2-yloxan-4-yl]ethyl]methanimine |
| PubChem CID | 6580000 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 1-(furan-2-yl)-N-[2-[(2S,4S)-4-(4-methylphenyl)-2-propan-2-yloxan-4-yl]ethyl]methanimine |
| SMILES | Cc1ccc([C@@]2(CC/N=C/c3ccco3)CCO[C@H](C(C)C)C2)cc1 |
| InChI | InChI=1S/C22H29NO2/c1-17(2)21-15-22(11-14-25-21,19-8-6-18(3)7-9-19)10-12-23-16-20-5-4-13-24-20/h4-9,13,16-17,21H,10-12,14-15H2,1-3H3/b23-16+/t21-,22-/m0/s1 |
| InChIKey | FLNVWIKRXYKORZ-BIDSZKBNSA-N |
| XLogP | 5.17 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(furan-2-yl)-N-[2-[(2S,4S)-4-(4-methylphenyl)-2-propan-2-yloxan-4-yl]ethyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(furan-2-yl)-N-[2-[(2S,4S)-4-(4-methylphenyl)-2-propan-2-yloxan-4-yl]ethyl]methanimine?
The IUPAC name of 1-(furan-2-yl)-N-[2-[(2S,4S)-4-(4-methylphenyl)-2-propan-2-yloxan-4-yl]ethyl]methanimine (CID 6580000) is 1-(furan-2-yl)-N-[2-[(2S,4S)-4-(4-methylphenyl)-2-propan-2-yloxan-4-yl]ethyl]methanimine.
What is the SMILES notation for 1-(furan-2-yl)-N-[2-[(2S,4S)-4-(4-methylphenyl)-2-propan-2-yloxan-4-yl]ethyl]methanimine?
The canonical SMILES for 1-(furan-2-yl)-N-[2-[(2S,4S)-4-(4-methylphenyl)-2-propan-2-yloxan-4-yl]ethyl]methanimine is Cc1ccc([C@@]2(CC/N=C/c3ccco3)CCO[C@H](C(C)C)C2)cc1.
What is the InChIKey of 1-(furan-2-yl)-N-[2-[(2S,4S)-4-(4-methylphenyl)-2-propan-2-yloxan-4-yl]ethyl]methanimine?
The InChIKey is FLNVWIKRXYKORZ-BIDSZKBNSA-N. The full InChI is InChI=1S/C22H29NO2/c1-17(2)21-15-22(11-14-25-21,19-8-6-18(3)7-9-19)10-12-23-16-20-5-4-13-24-20/h4-9,13,16-17,21H,10-12,14-15H2,1-3H3/b23-16+/t21-,22-/m0/s1.
What are the key properties of 1-(furan-2-yl)-N-[2-[(2S,4S)-4-(4-methylphenyl)-2-propan-2-yloxan-4-yl]ethyl]methanimine?
1-(furan-2-yl)-N-[2-[(2S,4S)-4-(4-methylphenyl)-2-propan-2-yloxan-4-yl]ethyl]methanimine has a molecular weight of 339.48 g/mol, XLogP of 5.17, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-2-yl)-N-[2-[(2S,4S)-4-(4-methylphenyl)-2-propan-2-yloxan-4-yl]ethyl]methanimine is sourced from PubChem (CID 6580000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).