C19H17N5O2S — CID 658037
ethyl (8R,8aR)-6-amino-5,7,7-tricyano-8-thiophen-2-yl-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate (PubChem CID 658037) has the molecular formula C19H17N5O2S and a molecular weight of 379.45 g/mol. Its IUPAC name is ethyl (8R,8aR)-6-amino-5,7,7-tricyano-8-thiophen-2-yl-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate.
| Compound Name | ethyl (8R,8aR)-6-amino-5,7,7-tricyano-8-thiophen-2-yl-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 658037 |
| Molecular Formula | C19H17N5O2S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | ethyl (8R,8aR)-6-amino-5,7,7-tricyano-8-thiophen-2-yl-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
| SMILES | CCOC(=O)N1CC=C2C(C#N)=C(N)C(C#N)(C#N)[C@H](c3cccs3)[C@H]2C1 |
| InChI | InChI=1S/C19H17N5O2S/c1-2-26-18(25)24-6-5-12-13(8-20)17(23)19(10-21,11-22)16(14(12)9-24)15-4-3-7-27-15/h3-5,7,14,16H,2,6,9,23H2,1H3/t14-,16-/m0/s1 |
| InChIKey | ZKKJIQYWHTXKBL-HOCLYGCPSA-N |
| XLogP | 2.63 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|