C15H11NO4S — CID 658040
1,1-dioxo-2-phenacyl-1,2-benzothiazol-3-one (PubChem CID 658040) has the molecular formula C15H11NO4S and a molecular weight of 301.32 g/mol. Its IUPAC name is 1,1-dioxo-2-phenacyl-1,2-benzothiazol-3-one.
| Compound Name | 1,1-dioxo-2-phenacyl-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 658040 |
| Molecular Formula | C15H11NO4S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 1,1-dioxo-2-phenacyl-1,2-benzothiazol-3-one |
| SMILES | O=C(CN1C(=O)c2ccccc2S1(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C15H11NO4S/c17-13(11-6-2-1-3-7-11)10-16-15(18)12-8-4-5-9-14(12)21(16,19)20/h1-9H,10H2 |
| InChIKey | QJWQWSQZQFNGQF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |