C20H29N3O2S — CID 658089
3,3-dimethyl-8-morpholin-4-yl-6-pentylsulfanyl-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile (PubChem CID 658089) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is 3,3-dimethyl-8-morpholin-4-yl-6-pentylsulfanyl-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile.
| Compound Name | 3,3-dimethyl-8-morpholin-4-yl-6-pentylsulfanyl-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 658089 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 3,3-dimethyl-8-morpholin-4-yl-6-pentylsulfanyl-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile |
| SMILES | CCCCCSc1nc(N2CCOCC2)c2c(c1C#N)CC(C)(C)OC2 |
| InChI | InChI=1S/C20H29N3O2S/c1-4-5-6-11-26-19-16(13-21)15-12-20(2,3)25-14-17(15)18(22-19)23-7-9-24-10-8-23/h4-12,14H2,1-3H3 |
| InChIKey | POOKDZDSXYRARJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 58.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|