C15H20N4O3 — CID 6581081
(1S,11S,15S)-11-morpholin-4-yl-10-oxido-4-oxa-3,5-diaza-10-azoniatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-triene (PubChem CID 6581081) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is (1S,11S,15S)-11-morpholin-4-yl-10-oxido-4-oxa-3,5-diaza-10-azoniatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-triene.
| Compound Name | (1S,11S,15S)-11-morpholin-4-yl-10-oxido-4-oxa-3,5-diaza-10-azoniatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-triene |
|---|---|
| PubChem CID | 6581081 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (1S,11S,15S)-11-morpholin-4-yl-10-oxido-4-oxa-3,5-diaza-10-azoniatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-triene |
| SMILES | [O-][N+]1=C2CCc3nonc3[C@@H]2[C@@H]2CCC[C@@]21N1CCOCC1 |
| InChI | InChI=1S/C15H20N4O3/c20-19-12-4-3-11-14(17-22-16-11)13(12)10-2-1-5-15(10,19)18-6-8-21-9-7-18/h10,13H,1-9H2/t10-,13+,15-/m0/s1 |
| InChIKey | VUVWTFLFMZIMLX-ZBINZKHDSA-N |
| XLogP | 0.89 |
| TPSA | 77.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|