C26H38O2 — CID 6581459
(1S,2S,4R)-1,7,7-trimethyl-2-[4-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]phenoxy]bicyclo[2.2.1]heptane (PubChem CID 6581459) has the molecular formula C26H38O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is (1S,2S,4R)-1,7,7-trimethyl-2-[4-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]phenoxy]bicyclo[2.2.1]heptane.
| Compound Name | (1S,2S,4R)-1,7,7-trimethyl-2-[4-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]phenoxy]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 6581459 |
| Molecular Formula | C26H38O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | (1S,2S,4R)-1,7,7-trimethyl-2-[4-[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]phenoxy]bicyclo[2.2.1]heptane |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@H](Oc1ccc(O[C@H]3C[C@H]4CC[C@@]3(C)C4(C)C)cc1)C2 |
| InChI | InChI=1S/C26H38O2/c1-23(2)17-11-13-25(23,5)21(15-17)27-19-7-9-20(10-8-19)28-22-16-18-12-14-26(22,6)24(18,3)4/h7-10,17-18,21-22H,11-16H2,1-6H3/t17-,18+,21+,22-,25-,26+ |
| InChIKey | WNOMWHYUDVIIQR-WAHBRWBSSA-N |
| XLogP | 6.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |